C23H23N3O2 — CID 113190574
N-(2-ethyl-6-methylphenyl)-5-oxo-1-quinolin-8-ylpyrrolidine-3-carboxamide (PubChem CID 113190574) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-5-oxo-1-quinolin-8-ylpyrrolidine-3-carboxamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-5-oxo-1-quinolin-8-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113190574 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-5-oxo-1-quinolin-8-ylpyrrolidine-3-carboxamide |
| SMILES | CCc1cccc(C)c1NC(=O)C1CC(=O)N(c2cccc3cccnc23)C1 |
| InChI | InChI=1S/C23H23N3O2/c1-3-16-8-4-7-15(2)21(16)25-23(28)18-13-20(27)26(14-18)19-11-5-9-17-10-6-12-24-22(17)19/h4-12,18H,3,13-14H2,1-2H3,(H,25,28) |
| InChIKey | BHWYZYUBNBRFKR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |