C34H39F3N4O — CID 11319146
(5S)-5-(3-anilinopropyl)-3-(2,5-difluorophenyl)-N-(6-fluoro-1-methylazepan-4-yl)-N-methyl-5-phenyl-2H-pyrrole-1-carboxamide (PubChem CID 11319146) has the molecular formula C34H39F3N4O and a molecular weight of 576.71 g/mol. Its IUPAC name is (5S)-5-(3-anilinopropyl)-3-(2,5-difluorophenyl)-N-(6-fluoro-1-methylazepan-4-yl)-N-methyl-5-phenyl-2H-pyrrole-1-carboxamide.
| Compound Name | (5S)-5-(3-anilinopropyl)-3-(2,5-difluorophenyl)-N-(6-fluoro-1-methylazepan-4-yl)-N-methyl-5-phenyl-2H-pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 11319146 |
| Molecular Formula | C34H39F3N4O |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | (5S)-5-(3-anilinopropyl)-3-(2,5-difluorophenyl)-N-(6-fluoro-1-methylazepan-4-yl)-N-methyl-5-phenyl-2H-pyrrole-1-carboxamide |
| SMILES | CN1CCC(N(C)C(=O)N2CC(c3cc(F)ccc3F)=C[C@@]2(CCCNc2ccccc2)c2ccccc2)CC(F)C1 |
| InChI | InChI=1S/C34H39F3N4O/c1-39-19-16-30(20-28(36)24-39)40(2)33(42)41-23-25(31-21-27(35)14-15-32(31)37)22-34(41,26-10-5-3-6-11-26)17-9-18-38-29-12-7-4-8-13-29/h3-8,10-15,21-22,28,30,38H,9,16-20,23-24H2,1-2H3/t28?,30?,34-/m0/s1 |
| InChIKey | FAVWIOCCTZVTLZ-NTXFTHPOSA-N |
| XLogP | 6.94 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|