C20H34ClN9O2 — CID 11319153
3,5-diamino-N-[N'-[4-[1-(5-amino-5-oxopentyl)piperidin-4-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 11319153) has the molecular formula C20H34ClN9O2 and a molecular weight of 468.01 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[1-(5-amino-5-oxopentyl)piperidin-4-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[1-(5-amino-5-oxopentyl)piperidin-4-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11319153 |
| Molecular Formula | C20H34ClN9O2 |
| Molecular Weight | 468.01 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[1-(5-amino-5-oxopentyl)piperidin-4-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | NC(=O)CCCCN1CCC(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1 |
| InChI | InChI=1S/C20H34ClN9O2/c21-16-18(24)28-17(23)15(27-16)19(32)29-20(25)26-9-3-1-5-13-7-11-30(12-8-13)10-4-2-6-14(22)31/h13H,1-12H2,(H2,22,31)(H4,23,24,28)(H3,25,26,29,32) |
| InChIKey | OKPQATIGTDNCRJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 191.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.01 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|