C21H22N4O3 — CID 113193404
3-[[6-[2-(4-methoxyphenyl)ethylamino]-2-methylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 113193404) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[[6-[2-(4-methoxyphenyl)ethylamino]-2-methylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[6-[2-(4-methoxyphenyl)ethylamino]-2-methylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113193404 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-[[6-[2-(4-methoxyphenyl)ethylamino]-2-methylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | COc1ccc(CCNc2cc(Nc3cccc(C(=O)O)c3)nc(C)n2)cc1 |
| InChI | InChI=1S/C21H22N4O3/c1-14-23-19(22-11-10-15-6-8-18(28-2)9-7-15)13-20(24-14)25-17-5-3-4-16(12-17)21(26)27/h3-9,12-13H,10-11H2,1-2H3,(H,26,27)(H2,22,23,24,25) |
| InChIKey | BTGPYAGNKZOXQT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |