C32H60O7Si2 — CID 11319489
prop-2-enyl (E,2R,3S,4S,6R,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-5,11-dioxododec-8-enoate (PubChem CID 11319489) has the molecular formula C32H60O7Si2 and a molecular weight of 613.00 g/mol. Its IUPAC name is prop-2-enyl (E,2R,3S,4S,6R,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-5,11-dioxododec-8-enoate.
| Compound Name | prop-2-enyl (E,2R,3S,4S,6R,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-5,11-dioxododec-8-enoate |
|---|---|
| PubChem CID | 11319489 |
| Molecular Formula | C32H60O7Si2 |
| Molecular Weight | 613.00 g/mol |
| Exact Mass | 612.39 |
| IUPAC Name | prop-2-enyl (E,2R,3S,4S,6R,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-5,11-dioxododec-8-enoate |
| SMILES | C=CCOC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)[C@H](C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)C(C)=O |
| InChI | InChI=1S/C32H60O7Si2/c1-18-19-37-30(35)29(39-41(16,17)32(10,11)12)28(36-13)24(5)26(34)23(4)27(22(3)20-21(2)25(6)33)38-40(14,15)31(7,8)9/h18,20-21,23-24,27-29H,1,19H2,2-17H3/b22-20+/t21-,23-,24+,27-,28-,29+/m0/s1 |
| InChIKey | QJSQHEFFWKRGGW-CLPFKIKQSA-N |
| XLogP | 7.52 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.00 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|