C18H14Cl2N4O2 — CID 113194960
2-[[6-(2,3-dichloroanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 113194960) has the molecular formula C18H14Cl2N4O2 and a molecular weight of 389.24 g/mol. Its IUPAC name is 2-[[6-(2,3-dichloroanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[6-(2,3-dichloroanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113194960 |
| Molecular Formula | C18H14Cl2N4O2 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-[[6-(2,3-dichloroanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | Cc1nc(Nc2ccccc2C(=O)O)cc(Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C18H14Cl2N4O2/c1-10-21-15(23-13-7-3-2-5-11(13)18(25)26)9-16(22-10)24-14-8-4-6-12(19)17(14)20/h2-9H,1H3,(H,25,26)(H2,21,22,23,24) |
| InChIKey | YSNJDENYKSVQNL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |