C19H18N4O3 — CID 113195006
2-[[6-[(2-methoxyphenyl)methylamino]pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113195006) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-[[6-[(2-methoxyphenyl)methylamino]pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[6-[(2-methoxyphenyl)methylamino]pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113195006 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[[6-[(2-methoxyphenyl)methylamino]pyrimidin-4-yl]amino]benzoic acid |
| SMILES | COc1ccccc1CNc1cc(Nc2ccccc2C(=O)O)ncn1 |
| InChI | InChI=1S/C19H18N4O3/c1-26-16-9-5-2-6-13(16)11-20-17-10-18(22-12-21-17)23-15-8-4-3-7-14(15)19(24)25/h2-10,12H,11H2,1H3,(H,24,25)(H2,20,21,22,23) |
| InChIKey | MYDGNSHAPQHJBN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |