C37H46O8 — CID 11319531
(1S)-1-[(2R,3R,4R,5R,6R)-4,5-bis[(4-methoxyphenyl)methoxy]-3-methyl-6-(2-methylprop-2-enyl)oxan-2-yl]-1-[(4-methoxyphenyl)methoxy]propan-2-one (PubChem CID 11319531) has the molecular formula C37H46O8 and a molecular weight of 618.77 g/mol. Its IUPAC name is (1S)-1-[(2R,3R,4R,5R,6R)-4,5-bis[(4-methoxyphenyl)methoxy]-3-methyl-6-(2-methylprop-2-enyl)oxan-2-yl]-1-[(4-methoxyphenyl)methoxy]propan-2-one.
| Compound Name | (1S)-1-[(2R,3R,4R,5R,6R)-4,5-bis[(4-methoxyphenyl)methoxy]-3-methyl-6-(2-methylprop-2-enyl)oxan-2-yl]-1-[(4-methoxyphenyl)methoxy]propan-2-one |
|---|---|
| PubChem CID | 11319531 |
| Molecular Formula | C37H46O8 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | (1S)-1-[(2R,3R,4R,5R,6R)-4,5-bis[(4-methoxyphenyl)methoxy]-3-methyl-6-(2-methylprop-2-enyl)oxan-2-yl]-1-[(4-methoxyphenyl)methoxy]propan-2-one |
| SMILES | C=C(C)C[C@H]1O[C@@H]([C@H](OCc2ccc(OC)cc2)C(C)=O)[C@H](C)[C@@H](OCc2ccc(OC)cc2)[C@@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C37H46O8/c1-24(2)20-33-37(44-23-29-12-18-32(41-7)19-13-29)34(42-21-27-8-14-30(39-5)15-9-27)25(3)35(45-33)36(26(4)38)43-22-28-10-16-31(40-6)17-11-28/h8-19,25,33-37H,1,20-23H2,2-7H3/t25-,33-,34-,35-,36-,37-/m1/s1 |
| InChIKey | ZFADGXDUJIHOFO-ZTEBFMQSSA-N |
| XLogP | 6.73 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|