C37H39ClF3N3O — CID 11319641
N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-[1-[2-(ethylamino)ethyl]indol-4-yl]oxypropan-1-amine (PubChem CID 11319641) has the molecular formula C37H39ClF3N3O and a molecular weight of 634.19 g/mol. Its IUPAC name is N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-[1-[2-(ethylamino)ethyl]indol-4-yl]oxypropan-1-amine.
| Compound Name | N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-[1-[2-(ethylamino)ethyl]indol-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 11319641 |
| Molecular Formula | C37H39ClF3N3O |
| Molecular Weight | 634.19 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-[1-[2-(ethylamino)ethyl]indol-4-yl]oxypropan-1-amine |
| SMILES | CCNCCn1ccc2c(OCCCN(Cc3cccc(C(F)(F)F)c3Cl)CC(c3ccccc3)c3ccccc3)cccc21 |
| InChI | InChI=1S/C37H39ClF3N3O/c1-2-42-21-24-44-23-20-31-34(44)18-10-19-35(31)45-25-11-22-43(26-30-16-9-17-33(36(30)38)37(39,40)41)27-32(28-12-5-3-6-13-28)29-14-7-4-8-15-29/h3-10,12-20,23,32,42H,2,11,21-22,24-27H2,1H3 |
| InChIKey | OHAFSDZIGQBKRC-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.19 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|