C22H25N3O — CID 113196626
(3E)-3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methylidene]-5-methyl-1H-indol-2-one (PubChem CID 113196626) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is (3E)-3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methylidene]-5-methyl-1H-indol-2-one.
| Compound Name | (3E)-3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methylidene]-5-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 113196626 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (3E)-3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methylidene]-5-methyl-1H-indol-2-one |
| SMILES | Cc1ccc2c(c1)/C(=C\N1CCN(c3cccc(C)c3C)CC1)C(=O)N2 |
| InChI | InChI=1S/C22H25N3O/c1-15-7-8-20-18(13-15)19(22(26)23-20)14-24-9-11-25(12-10-24)21-6-4-5-16(2)17(21)3/h4-8,13-14H,9-12H2,1-3H3,(H,23,26)/b19-14+ |
| InChIKey | HDSZRHRYKPFRGF-XMHGGMMESA-N |
| XLogP | 3.73 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|