C18H19NO3 — CID 113197703
2-(1,3-benzodioxol-5-yl)-N-benzyl-2-methylpropanamide (PubChem CID 113197703) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-benzyl-2-methylpropanamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-benzyl-2-methylpropanamide |
|---|---|
| PubChem CID | 113197703 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-benzyl-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NCc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H19NO3/c1-18(2,14-8-9-15-16(10-14)22-12-21-15)17(20)19-11-13-6-4-3-5-7-13/h3-10H,11-12H2,1-2H3,(H,19,20) |
| InChIKey | OBMYBNFODDGXIB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |