C18H21N3O3 — CID 113199321
3,4-dihydroxy-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide (PubChem CID 113199321) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3,4-dihydroxy-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 3,4-dihydroxy-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 113199321 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3,4-dihydroxy-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3ccc(O)c(O)c3)cc2)CC1 |
| InChI | InChI=1S/C18H21N3O3/c1-20-8-10-21(11-9-20)15-5-3-14(4-6-15)19-18(24)13-2-7-16(22)17(23)12-13/h2-7,12,22-23H,8-11H2,1H3,(H,19,24) |
| InChIKey | MVSMXANEXXVVGY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|