C20H22N2O3 — CID 113199636
1-(3-phenylpropyl)-3-(2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)urea (PubChem CID 113199636) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(3-phenylpropyl)-3-(2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)urea.
| Compound Name | 1-(3-phenylpropyl)-3-(2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)urea |
|---|---|
| PubChem CID | 113199636 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-(3-phenylpropyl)-3-(2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)urea |
| SMILES | O=C(NCCCc1ccccc1)Nc1c2c(cc3c1OCC3)OCC2 |
| InChI | InChI=1S/C20H22N2O3/c23-20(21-10-4-7-14-5-2-1-3-6-14)22-18-16-9-12-24-17(16)13-15-8-11-25-19(15)18/h1-3,5-6,13H,4,7-12H2,(H2,21,22,23) |
| InChIKey | DRCKAPWMZLEROJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|