C34H50N2O11S — CID 11319990
5-decyl-N-(4-nitrophenyl)sulfonyl-2-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)benzamide (PubChem CID 11319990) has the molecular formula C34H50N2O11S and a molecular weight of 694.84 g/mol. Its IUPAC name is 5-decyl-N-(4-nitrophenyl)sulfonyl-2-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)benzamide.
| Compound Name | 5-decyl-N-(4-nitrophenyl)sulfonyl-2-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 11319990 |
| Molecular Formula | C34H50N2O11S |
| Molecular Weight | 694.84 g/mol |
| Exact Mass | 694.31 |
| IUPAC Name | 5-decyl-N-(4-nitrophenyl)sulfonyl-2-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)benzamide |
| SMILES | CCCCCCCCCCc1ccc(OCC2COCCOCCOCCOCCO2)c(C(=O)NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C34H50N2O11S/c1-2-3-4-5-6-7-8-9-10-28-11-16-33(47-27-30-26-45-22-21-43-18-17-42-19-20-44-23-24-46-30)32(25-28)34(37)35-48(40,41)31-14-12-29(13-15-31)36(38)39/h11-16,25,30H,2-10,17-24,26-27H2,1H3,(H,35,37) |
| InChIKey | HZZDXVCMEILJSD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 161.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|