C21H24N2O3 — CID 113200075
N-[4-(diethylamino)phenyl]-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-carboxamide (PubChem CID 113200075) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 113200075 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2c3c(cc4c2OCC4)OCC3)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-3-23(4-2)16-7-5-15(6-8-16)22-21(24)19-17-10-12-25-18(17)13-14-9-11-26-20(14)19/h5-8,13H,3-4,9-12H2,1-2H3,(H,22,24) |
| InChIKey | ZMTFSFIJWUMORR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|