C23H28N4O — CID 113201225
N-[4-(diethylamino)phenyl]-3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide (PubChem CID 113201225) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide |
|---|---|
| PubChem CID | 113201225 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-8-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2CCc3nc4cc(C)ccn4c3C2)cc1 |
| InChI | InChI=1S/C23H28N4O/c1-4-26(5-2)19-9-7-18(8-10-19)24-23(28)17-6-11-20-21(15-17)27-13-12-16(3)14-22(27)25-20/h7-10,12-14,17H,4-6,11,15H2,1-3H3,(H,24,28) |
| InChIKey | GTZBAXZWWKBJEH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|