C18H15ClN2O3 — CID 113201305
2-(4-chloro-1,3-dioxoisoindol-2-yl)-N-(2-phenylethyl)acetamide (PubChem CID 113201305) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is 2-(4-chloro-1,3-dioxoisoindol-2-yl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-(4-chloro-1,3-dioxoisoindol-2-yl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 113201305 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-(4-chloro-1,3-dioxoisoindol-2-yl)-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc(Cl)c2C1=O)NCCc1ccccc1 |
| InChI | InChI=1S/C18H15ClN2O3/c19-14-8-4-7-13-16(14)18(24)21(17(13)23)11-15(22)20-10-9-12-5-2-1-3-6-12/h1-8H,9-11H2,(H,20,22) |
| InChIKey | TZPPAXPUWDNZHA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|