C19H18N4O5 — CID 113202549
6-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 113202549) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is 6-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 113202549 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 6-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C(CCN1C(=O)c2cccnc2C1=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C19H18N4O5/c24-15(5-7-23-17(25)13-3-1-6-20-16(13)19(23)27)21-8-10-22(11-9-21)18(26)14-4-2-12-28-14/h1-4,6,12H,5,7-11H2 |
| InChIKey | LLOBDVSCMCCVAM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|