C17H17N3O — CID 113204984
3,6-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 113204984) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 3,6-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | 3,6-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113204984 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3,6-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2c(C)c(C(=O)NCc3cccnc3)[nH]c2c1 |
| InChI | InChI=1S/C17H17N3O/c1-11-5-6-14-12(2)16(20-15(14)8-11)17(21)19-10-13-4-3-7-18-9-13/h3-9,20H,10H2,1-2H3,(H,19,21) |
| InChIKey | PUJSLVXBHNARSE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|