About N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide
N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide (PubChem CID 113205023) has the molecular formula C16H22N2O
and a molecular weight of 258.36 g/mol. Its IUPAC name is N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide |
| PubChem CID | 113205023 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide |
| SMILES | CCCCN(C)C(=O)c1[nH]c2cc(C)ccc2c1C |
| InChI | InChI=1S/C16H22N2O/c1-5-6-9-18(4)16(19)15-12(3)13-8-7-11(2)10-14(13)17-15/h7-8,10,17H,5-6,9H2,1-4H3 |
| InChIKey | PFXCNOIQVOZJOR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide?
The IUPAC name of N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide (CID 113205023) is N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide.
What is the SMILES notation for N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide?
The canonical SMILES for N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide is CCCCN(C)C(=O)c1[nH]c2cc(C)ccc2c1C.
What is the InChIKey of N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide?
The InChIKey is PFXCNOIQVOZJOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O/c1-5-6-9-18(4)16(19)15-12(3)13-8-7-11(2)10-14(13)17-15/h7-8,10,17H,5-6,9H2,1-4H3.
What are the key properties of N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide?
N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide has a molecular weight of 258.36 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,3,6-trimethyl-1H-indole-2-carboxamide is sourced from PubChem (CID 113205023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).