About tetrakis(3,5-difluorophenyl)boranuide
tetrakis(3,5-difluorophenyl)boranuide (PubChem CID 11320769) has the molecular formula C24H12BF8-
and a molecular weight of 463.16 g/mol. Its IUPAC name is tetrakis(3,5-difluorophenyl)boranuide.
Molecular Properties
| Compound Name | tetrakis(3,5-difluorophenyl)boranuide |
| PubChem CID | 11320769 |
| Molecular Formula | C24H12BF8- |
| Molecular Weight | 463.16 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | tetrakis(3,5-difluorophenyl)boranuide |
| SMILES | Fc1cc(F)cc([B-](c2cc(F)cc(F)c2)(c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C24H12BF8/c26-17-1-13(2-18(27)9-17)25(14-3-19(28)10-20(29)4-14,15-5-21(30)11-22(31)6-15)16-7-23(32)12-24(33)8-16/h1-12H/q-1 |
| InChIKey | GOUQAUQJGPJUOD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.16 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(3,5-difluorophenyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(3,5-difluorophenyl)boranuide?
The IUPAC name of tetrakis(3,5-difluorophenyl)boranuide (CID 11320769) is tetrakis(3,5-difluorophenyl)boranuide.
What is the SMILES notation for tetrakis(3,5-difluorophenyl)boranuide?
The canonical SMILES for tetrakis(3,5-difluorophenyl)boranuide is Fc1cc(F)cc([B-](c2cc(F)cc(F)c2)(c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)c1.
What is the InChIKey of tetrakis(3,5-difluorophenyl)boranuide?
The InChIKey is GOUQAUQJGPJUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H12BF8/c26-17-1-13(2-18(27)9-17)25(14-3-19(28)10-20(29)4-14,15-5-21(30)11-22(31)6-15)16-7-23(32)12-24(33)8-16/h1-12H/q-1.
What are the key properties of tetrakis(3,5-difluorophenyl)boranuide?
tetrakis(3,5-difluorophenyl)boranuide has a molecular weight of 463.16 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(3,5-difluorophenyl)boranuide is sourced from PubChem (CID 11320769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).