C14H15FN2O2 — CID 113208017
N-butyl-2-(5-fluoro-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 113208017) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is N-butyl-2-(5-fluoro-1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-butyl-2-(5-fluoro-1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 113208017 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-butyl-2-(5-fluoro-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | CCCCNC(=O)C(=O)c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C14H15FN2O2/c1-2-3-6-16-14(19)13(18)11-8-17-12-5-4-9(15)7-10(11)12/h4-5,7-8,17H,2-3,6H2,1H3,(H,16,19) |
| InChIKey | LGSKYMCTYFFTPU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|