C19H18N2O3 — CID 113208450
N-(2-ethylphenyl)-2-(5-methoxy-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 113208450) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-(5-methoxy-1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-(2-ethylphenyl)-2-(5-methoxy-1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 113208450 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-(2-ethylphenyl)-2-(5-methoxy-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)c1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C19H18N2O3/c1-3-12-6-4-5-7-16(12)21-19(23)18(22)15-11-20-17-9-8-13(24-2)10-14(15)17/h4-11,20H,3H2,1-2H3,(H,21,23) |
| InChIKey | QKJDAUGUXYMKAP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|