About methyl 2-sulfanylideneacetate
methyl 2-sulfanylideneacetate (PubChem CID 11320912) has the molecular formula C3H4O2S
and a molecular weight of 104.13 g/mol. Its IUPAC name is methyl 2-sulfanylideneacetate.
Molecular Properties
| Compound Name | methyl 2-sulfanylideneacetate |
| PubChem CID | 11320912 |
| Molecular Formula | C3H4O2S |
| Molecular Weight | 104.13 g/mol |
| Exact Mass | 103.99 |
| IUPAC Name | methyl 2-sulfanylideneacetate |
| SMILES | COC(=O)C=S |
| InChI | InChI=1S/C3H4O2S/c1-5-3(4)2-6/h2H,1H3 |
| InChIKey | VPATVNCRODJCOM-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.13 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-sulfanylideneacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-sulfanylideneacetate?
The IUPAC name of methyl 2-sulfanylideneacetate (CID 11320912) is methyl 2-sulfanylideneacetate.
What is the SMILES notation for methyl 2-sulfanylideneacetate?
The canonical SMILES for methyl 2-sulfanylideneacetate is COC(=O)C=S.
What is the InChIKey of methyl 2-sulfanylideneacetate?
The InChIKey is VPATVNCRODJCOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2S/c1-5-3(4)2-6/h2H,1H3.
What are the key properties of methyl 2-sulfanylideneacetate?
methyl 2-sulfanylideneacetate has a molecular weight of 104.13 g/mol, XLogP of 0.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-sulfanylideneacetate is sourced from PubChem (CID 11320912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).