C19H17ClN2O4 — CID 113209690
methyl 4-chloro-3-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]benzoate (PubChem CID 113209690) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 113209690 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | methyl 4-chloro-3-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)Cc2c[nH]c3ccc(OC)cc23)c1 |
| InChI | InChI=1S/C19H17ClN2O4/c1-25-13-4-6-16-14(9-13)12(10-21-16)8-18(23)22-17-7-11(19(24)26-2)3-5-15(17)20/h3-7,9-10,21H,8H2,1-2H3,(H,22,23) |
| InChIKey | QKKDWIOPPLUYCE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |