About Cyclohexyldimethylsilane
Cyclohexyldimethylsilane (PubChem CID 11320997) has the molecular formula C8H17Si
and a molecular weight of 141.31 g/mol.
Molecular Properties
| Compound Name | Cyclohexyldimethylsilane |
| PubChem CID | 11320997 |
| Molecular Formula | C8H17Si |
| Molecular Weight | 141.31 g/mol |
| Exact Mass | 141.11 |
| IUPAC Name | — |
| SMILES | C[Si](C)C1CCCCC1 |
| InChI | InChI=1S/C8H17Si/c1-9(2)8-6-4-3-5-7-8/h8H,3-7H2,1-2H3 |
| InChIKey | JFDSHJDHYXKJFG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Cyclohexyldimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyclohexyldimethylsilane?
The IUPAC name of Cyclohexyldimethylsilane (CID 11320997) is not available.
What is the SMILES notation for Cyclohexyldimethylsilane?
The canonical SMILES for Cyclohexyldimethylsilane is C[Si](C)C1CCCCC1.
What is the InChIKey of Cyclohexyldimethylsilane?
The InChIKey is JFDSHJDHYXKJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17Si/c1-9(2)8-6-4-3-5-7-8/h8H,3-7H2,1-2H3.
What are the key properties of Cyclohexyldimethylsilane?
Cyclohexyldimethylsilane has a molecular weight of 141.31 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclohexyldimethylsilane is sourced from PubChem (CID 11320997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).