C20H19FN2O3 — CID 113209989
methyl 2-[[2-(5-fluoro-1H-indol-3-yl)-2-methylpropanoyl]amino]benzoate (PubChem CID 113209989) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is methyl 2-[[2-(5-fluoro-1H-indol-3-yl)-2-methylpropanoyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(5-fluoro-1H-indol-3-yl)-2-methylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 113209989 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | methyl 2-[[2-(5-fluoro-1H-indol-3-yl)-2-methylpropanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)(C)c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C20H19FN2O3/c1-20(2,15-11-22-16-9-8-12(21)10-14(15)16)19(25)23-17-7-5-4-6-13(17)18(24)26-3/h4-11,22H,1-3H3,(H,23,25) |
| InChIKey | WUPUCIVNGMUJLJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |