About 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran
6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran (PubChem CID 11321053) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran |
| PubChem CID | 11321053 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran |
| SMILES | C1=COC(C2=CCCCO2)C1 |
| InChI | InChI=1S/C9H12O2/c1-2-6-10-8(4-1)9-5-3-7-11-9/h3-4,7,9H,1-2,5-6H2 |
| InChIKey | GMKYJNHVPXNRMJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran?
The IUPAC name of 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran (CID 11321053) is 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran.
What is the SMILES notation for 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran?
The canonical SMILES for 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran is C1=COC(C2=CCCCO2)C1.
What is the InChIKey of 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran?
The InChIKey is GMKYJNHVPXNRMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-2-6-10-8(4-1)9-5-3-7-11-9/h3-4,7,9H,1-2,5-6H2.
What are the key properties of 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran?
6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran has a molecular weight of 152.19 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dihydrofuran-2-yl)-3,4-dihydro-2H-pyran is sourced from PubChem (CID 11321053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).