C19H16ClFN2O — CID 113210934
1-(5-chloro-1H-indol-3-yl)-N-[(4-fluorophenyl)methyl]cyclopropane-1-carboxamide (PubChem CID 113210934) has the molecular formula C19H16ClFN2O and a molecular weight of 342.80 g/mol. Its IUPAC name is 1-(5-chloro-1H-indol-3-yl)-N-[(4-fluorophenyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(5-chloro-1H-indol-3-yl)-N-[(4-fluorophenyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 113210934 |
| Molecular Formula | C19H16ClFN2O |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-(5-chloro-1H-indol-3-yl)-N-[(4-fluorophenyl)methyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C1(c2c[nH]c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C19H16ClFN2O/c20-13-3-6-17-15(9-13)16(11-22-17)19(7-8-19)18(24)23-10-12-1-4-14(21)5-2-12/h1-6,9,11,22H,7-8,10H2,(H,23,24) |
| InChIKey | QTJFXSXLVUGJOK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |