About N-bromobutanamide
N-bromobutanamide (PubChem CID 11321160) has the molecular formula C4H8BrNO
and a molecular weight of 166.02 g/mol. Its IUPAC name is N-bromobutanamide.
Molecular Properties
| Compound Name | N-bromobutanamide |
| PubChem CID | 11321160 |
| Molecular Formula | C4H8BrNO |
| Molecular Weight | 166.02 g/mol |
| Exact Mass | 164.98 |
| IUPAC Name | N-bromobutanamide |
| SMILES | CCCC(=O)NBr |
| InChI | InChI=1S/C4H8BrNO/c1-2-3-4(7)6-5/h2-3H2,1H3,(H,6,7) |
| InChIKey | IVOLAUJTLCAWRZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.02 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-bromobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bromobutanamide?
The IUPAC name of N-bromobutanamide (CID 11321160) is N-bromobutanamide.
What is the SMILES notation for N-bromobutanamide?
The canonical SMILES for N-bromobutanamide is CCCC(=O)NBr.
What is the InChIKey of N-bromobutanamide?
The InChIKey is IVOLAUJTLCAWRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8BrNO/c1-2-3-4(7)6-5/h2-3H2,1H3,(H,6,7).
What are the key properties of N-bromobutanamide?
N-bromobutanamide has a molecular weight of 166.02 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-bromobutanamide is sourced from PubChem (CID 11321160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).