C5H6N2O3S — CID 11321243
1-(1,3-thiazol-2-yl)ethyl nitrate (PubChem CID 11321243) has the molecular formula C5H6N2O3S and a molecular weight of 174.18 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)ethyl nitrate.
| Compound Name | 1-(1,3-thiazol-2-yl)ethyl nitrate |
|---|---|
| PubChem CID | 11321243 |
| Molecular Formula | C5H6N2O3S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)ethyl nitrate |
| SMILES | CC(O[N+](=O)[O-])c1nccs1 |
| InChI | InChI=1S/C5H6N2O3S/c1-4(10-7(8)9)5-6-2-3-11-5/h2-4H,1H3 |
| InChIKey | MHPISUHOUVWSKU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|