C16H19ClN2O2 — CID 113212590
1-acetyl-5-chloro-N-(3-methylbutyl)indole-3-carboxamide (PubChem CID 113212590) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 1-acetyl-5-chloro-N-(3-methylbutyl)indole-3-carboxamide.
| Compound Name | 1-acetyl-5-chloro-N-(3-methylbutyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 113212590 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-acetyl-5-chloro-N-(3-methylbutyl)indole-3-carboxamide |
| SMILES | CC(=O)n1cc(C(=O)NCCC(C)C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H19ClN2O2/c1-10(2)6-7-18-16(21)14-9-19(11(3)20)15-5-4-12(17)8-13(14)15/h4-5,8-10H,6-7H2,1-3H3,(H,18,21) |
| InChIKey | BKGMJCDXPFYHIL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |