About 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran
6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran (PubChem CID 11321491) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran |
| PubChem CID | 11321491 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran |
| SMILES | C=C/C(C)=C(/OCC)C1=CCCCO1 |
| InChI | InChI=1S/C12H18O2/c1-4-10(3)12(13-5-2)11-8-6-7-9-14-11/h4,8H,1,5-7,9H2,2-3H3/b12-10+ |
| InChIKey | XZLRUCREXBQNPO-ZRDIBKRKSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran?
The IUPAC name of 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran (CID 11321491) is 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran.
What is the SMILES notation for 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran?
The canonical SMILES for 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran is C=C/C(C)=C(/OCC)C1=CCCCO1.
What is the InChIKey of 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran?
The InChIKey is XZLRUCREXBQNPO-ZRDIBKRKSA-N. The full InChI is InChI=1S/C12H18O2/c1-4-10(3)12(13-5-2)11-8-6-7-9-14-11/h4,8H,1,5-7,9H2,2-3H3/b12-10+.
What are the key properties of 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran?
6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran has a molecular weight of 194.27 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1E)-1-ethoxy-2-methylbuta-1,3-dienyl]-3,4-dihydro-2H-pyran is sourced from PubChem (CID 11321491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).