C18H18F2N2O — CID 113215039
1-(3,4-difluorophenyl)-3-[(1-phenylcyclobutyl)methyl]urea (PubChem CID 113215039) has the molecular formula C18H18F2N2O and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[(1-phenylcyclobutyl)methyl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[(1-phenylcyclobutyl)methyl]urea |
|---|---|
| PubChem CID | 113215039 |
| Molecular Formula | C18H18F2N2O |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[(1-phenylcyclobutyl)methyl]urea |
| SMILES | O=C(NCC1(c2ccccc2)CCC1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H18F2N2O/c19-15-8-7-14(11-16(15)20)22-17(23)21-12-18(9-4-10-18)13-5-2-1-3-6-13/h1-3,5-8,11H,4,9-10,12H2,(H2,21,22,23) |
| InChIKey | BMQDMWJQLCESAE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |