C17H17ClN2O — CID 113215464
1-[1-(4-chlorophenyl)cyclopropyl]-3-(2-methylphenyl)urea (PubChem CID 113215464) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)cyclopropyl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[1-(4-chlorophenyl)cyclopropyl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 113215464 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-[1-(4-chlorophenyl)cyclopropyl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NC1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H17ClN2O/c1-12-4-2-3-5-15(12)19-16(21)20-17(10-11-17)13-6-8-14(18)9-7-13/h2-9H,10-11H2,1H3,(H2,19,20,21) |
| InChIKey | XSHSHOZHCNCSEW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |