About cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate
cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate (PubChem CID 11321581) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate |
| PubChem CID | 11321581 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)C(=O)CCCC[C@@H]1O |
| InChI | InChI=1S/C10H16O4/c1-10(9(13)14-2)7(11)5-3-4-6-8(10)12/h7,11H,3-6H2,1-2H3/t7-,10-/m0/s1 |
| InChIKey | SEUNRVYRCMORPG-XVKPBYJWSA-N |
| XLogP | 0.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate?
The IUPAC name of cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate (CID 11321581) is cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate.
What is the SMILES notation for cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate?
The canonical SMILES for cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate is COC(=O)[C@]1(C)C(=O)CCCC[C@@H]1O.
What is the InChIKey of cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate?
The InChIKey is SEUNRVYRCMORPG-XVKPBYJWSA-N. The full InChI is InChI=1S/C10H16O4/c1-10(9(13)14-2)7(11)5-3-4-6-8(10)12/h7,11H,3-6H2,1-2H3/t7-,10-/m0/s1.
What are the key properties of cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate?
cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate has a molecular weight of 200.23 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1S,2S)-2-hydroxy-1-methyl-7-oxocycloheptane-1-carboxylate is sourced from PubChem (CID 11321581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).