C22H25N3O3 — CID 113216057
1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropyl]-3-(4-pyrrolidin-1-ylphenyl)urea (PubChem CID 113216057) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropyl]-3-(4-pyrrolidin-1-ylphenyl)urea.
| Compound Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropyl]-3-(4-pyrrolidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 113216057 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropyl]-3-(4-pyrrolidin-1-ylphenyl)urea |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)NC1(c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C22H25N3O3/c26-21(23-17-4-6-18(7-5-17)25-11-1-2-12-25)24-22(9-10-22)16-3-8-19-20(15-16)28-14-13-27-19/h3-8,15H,1-2,9-14H2,(H2,23,24,26) |
| InChIKey | UFLRURGULHNRNZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|