C19H23ClN2O2 — CID 113216348
1-[2-(4-chlorophenyl)propan-2-yl]-3-(4-propan-2-yloxyphenyl)urea (PubChem CID 113216348) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)propan-2-yl]-3-(4-propan-2-yloxyphenyl)urea.
| Compound Name | 1-[2-(4-chlorophenyl)propan-2-yl]-3-(4-propan-2-yloxyphenyl)urea |
|---|---|
| PubChem CID | 113216348 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[2-(4-chlorophenyl)propan-2-yl]-3-(4-propan-2-yloxyphenyl)urea |
| SMILES | CC(C)Oc1ccc(NC(=O)NC(C)(C)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H23ClN2O2/c1-13(2)24-17-11-9-16(10-12-17)21-18(23)22-19(3,4)14-5-7-15(20)8-6-14/h5-13H,1-4H3,(H2,21,22,23) |
| InChIKey | DKPKHEFAYSQSLV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |