C21H28N2O2 — CID 113216496
1-(2,6-diethylphenyl)-3-[2-(4-methoxyphenyl)propan-2-yl]urea (PubChem CID 113216496) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[2-(4-methoxyphenyl)propan-2-yl]urea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[2-(4-methoxyphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 113216496 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[2-(4-methoxyphenyl)propan-2-yl]urea |
| SMILES | CCc1cccc(CC)c1NC(=O)NC(C)(C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H28N2O2/c1-6-15-9-8-10-16(7-2)19(15)22-20(24)23-21(3,4)17-11-13-18(25-5)14-12-17/h8-14H,6-7H2,1-5H3,(H2,22,23,24) |
| InChIKey | XBDLHIITMOIQSW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |