C17H17BrN2O3 — CID 113217527
1-(2-bromophenyl)-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]urea (PubChem CID 113217527) has the molecular formula C17H17BrN2O3 and a molecular weight of 377.24 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]urea |
|---|---|
| PubChem CID | 113217527 |
| Molecular Formula | C17H17BrN2O3 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-(2-bromophenyl)-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]urea |
| SMILES | O=C(NCCc1ccc2c(c1)OCCO2)Nc1ccccc1Br |
| InChI | InChI=1S/C17H17BrN2O3/c18-13-3-1-2-4-14(13)20-17(21)19-8-7-12-5-6-15-16(11-12)23-10-9-22-15/h1-6,11H,7-10H2,(H2,19,20,21) |
| InChIKey | XVGFYHDGAFCZEQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |