About 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one
5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one (PubChem CID 11321827) has the molecular formula C9H6ClFN2O
and a molecular weight of 212.61 g/mol. Its IUPAC name is 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one |
| PubChem CID | 11321827 |
| Molecular Formula | C9H6ClFN2O |
| Molecular Weight | 212.61 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one |
| SMILES | O=c1cc(-c2ccc(Cl)cc2F)[nH][nH]1 |
| InChI | InChI=1S/C9H6ClFN2O/c10-5-1-2-6(7(11)3-5)8-4-9(14)13-12-8/h1-4H,(H2,12,13,14) |
| InChIKey | VCBLDCIWEYANRU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one (CID 11321827) is 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one is O=c1cc(-c2ccc(Cl)cc2F)[nH][nH]1.
What is the InChIKey of 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one?
The InChIKey is VCBLDCIWEYANRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClFN2O/c10-5-1-2-6(7(11)3-5)8-4-9(14)13-12-8/h1-4H,(H2,12,13,14).
What are the key properties of 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one?
5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one has a molecular weight of 212.61 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chloro-2-fluorophenyl)-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 11321827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).