About 1-(2,4,5-trifluorophenyl)piperazine
1-(2,4,5-trifluorophenyl)piperazine (PubChem CID 11321882) has the molecular formula C10H11F3N2
and a molecular weight of 216.21 g/mol. Its IUPAC name is 1-(2,4,5-trifluorophenyl)piperazine.
Molecular Properties
| Compound Name | 1-(2,4,5-trifluorophenyl)piperazine |
| PubChem CID | 11321882 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(2,4,5-trifluorophenyl)piperazine |
| SMILES | Fc1cc(F)c(N2CCNCC2)cc1F |
| InChI | InChI=1S/C10H11F3N2/c11-7-5-9(13)10(6-8(7)12)15-3-1-14-2-4-15/h5-6,14H,1-4H2 |
| InChIKey | WVAKHIYATQYPCS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4,5-trifluorophenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4,5-trifluorophenyl)piperazine?
The IUPAC name of 1-(2,4,5-trifluorophenyl)piperazine (CID 11321882) is 1-(2,4,5-trifluorophenyl)piperazine.
What is the SMILES notation for 1-(2,4,5-trifluorophenyl)piperazine?
The canonical SMILES for 1-(2,4,5-trifluorophenyl)piperazine is Fc1cc(F)c(N2CCNCC2)cc1F.
What is the InChIKey of 1-(2,4,5-trifluorophenyl)piperazine?
The InChIKey is WVAKHIYATQYPCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2/c11-7-5-9(13)10(6-8(7)12)15-3-1-14-2-4-15/h5-6,14H,1-4H2.
What are the key properties of 1-(2,4,5-trifluorophenyl)piperazine?
1-(2,4,5-trifluorophenyl)piperazine has a molecular weight of 216.21 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4,5-trifluorophenyl)piperazine is sourced from PubChem (CID 11321882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).