C12H25N3O2 — CID 113219551
N-butan-2-yl-2-[[2-(tert-butylamino)-2-oxoethyl]amino]acetamide (PubChem CID 113219551) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-butan-2-yl-2-[[2-(tert-butylamino)-2-oxoethyl]amino]acetamide.
| Compound Name | N-butan-2-yl-2-[[2-(tert-butylamino)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 113219551 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | N-butan-2-yl-2-[[2-(tert-butylamino)-2-oxoethyl]amino]acetamide |
| SMILES | CCC(C)NC(=O)CNCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H25N3O2/c1-6-9(2)14-10(16)7-13-8-11(17)15-12(3,4)5/h9,13H,6-8H2,1-5H3,(H,14,16)(H,15,17) |
| InChIKey | HUGQLDAATMWFLS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |