C15H19NO — CID 113219800
1-[2-(2-methoxyphenyl)ethyl]-2,5-dimethylpyrrole (PubChem CID 113219800) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)ethyl]-2,5-dimethylpyrrole.
| Compound Name | 1-[2-(2-methoxyphenyl)ethyl]-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 113219800 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)ethyl]-2,5-dimethylpyrrole |
| SMILES | COc1ccccc1CCn1c(C)ccc1C |
| InChI | InChI=1S/C15H19NO/c1-12-8-9-13(2)16(12)11-10-14-6-4-5-7-15(14)17-3/h4-9H,10-11H2,1-3H3 |
| InChIKey | NLGLXVSYYCOXOG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |