C12H17NO3S2 — CID 113220436
oxan-2-ylmethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate (PubChem CID 113220436) has the molecular formula C12H17NO3S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is oxan-2-ylmethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate.
| Compound Name | oxan-2-ylmethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate |
|---|---|
| PubChem CID | 113220436 |
| Molecular Formula | C12H17NO3S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | oxan-2-ylmethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)OCC1CCCCO1 |
| InChI | InChI=1S/C12H17NO3S2/c1-8-10(18-12(17)13-8)6-11(14)16-7-9-4-2-3-5-15-9/h9H,2-7H2,1H3,(H,13,17) |
| InChIKey | VGGSDAVTTKFJGJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|