About 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole
5-(4-butoxyphenyl)-4-methyl-1,2-oxazole (PubChem CID 11322201) has the molecular formula C14H17NO2
and a molecular weight of 231.30 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole |
| PubChem CID | 11322201 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole |
| SMILES | CCCCOc1ccc(-c2oncc2C)cc1 |
| InChI | InChI=1S/C14H17NO2/c1-3-4-9-16-13-7-5-12(6-8-13)14-11(2)10-15-17-14/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | KWEADCNYIUWGLT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole?
The IUPAC name of 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole (CID 11322201) is 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole.
What is the SMILES notation for 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole?
The canonical SMILES for 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole is CCCCOc1ccc(-c2oncc2C)cc1.
What is the InChIKey of 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole?
The InChIKey is KWEADCNYIUWGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c1-3-4-9-16-13-7-5-12(6-8-13)14-11(2)10-15-17-14/h5-8,10H,3-4,9H2,1-2H3.
What are the key properties of 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole?
5-(4-butoxyphenyl)-4-methyl-1,2-oxazole has a molecular weight of 231.30 g/mol, XLogP of 3.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-butoxyphenyl)-4-methyl-1,2-oxazole is sourced from PubChem (CID 11322201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).