C11H18N4O2 — CID 113222241
6-(3-cyclopentylpropylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 113222241) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 6-(3-cyclopentylpropylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(3-cyclopentylpropylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 113222241 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 6-(3-cyclopentylpropylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NCCCC2CCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H18N4O2/c16-10-9(14-15-11(17)13-10)12-7-3-6-8-4-1-2-5-8/h8H,1-7H2,(H,12,14)(H2,13,15,16,17) |
| InChIKey | MCZONVCYLCWRHR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|