C21H37N3 — CID 113222336
4-N-(1-benzylpiperidin-3-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 113222336) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is 4-N-(1-benzylpiperidin-3-yl)-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | 4-N-(1-benzylpiperidin-3-yl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 113222336 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 4-N-(1-benzylpiperidin-3-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)NC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H37N3/c1-4-23(5-2)15-9-11-19(3)22-21-14-10-16-24(18-21)17-20-12-7-6-8-13-20/h6-8,12-13,19,21-22H,4-5,9-11,14-18H2,1-3H3 |
| InChIKey | VBRVPRCCWGKBST-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |