C14H21NO3 — CID 113223150
3,3-dimethylbutyl 2-amino-4-methoxybenzoate (PubChem CID 113223150) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3,3-dimethylbutyl 2-amino-4-methoxybenzoate.
| Compound Name | 3,3-dimethylbutyl 2-amino-4-methoxybenzoate |
|---|---|
| PubChem CID | 113223150 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3,3-dimethylbutyl 2-amino-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCC(C)(C)C)c(N)c1 |
| InChI | InChI=1S/C14H21NO3/c1-14(2,3)7-8-18-13(16)11-6-5-10(17-4)9-12(11)15/h5-6,9H,7-8,15H2,1-4H3 |
| InChIKey | QPCWJCJIOJWJJO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|