C15H24O2 — CID 11322327
(1S,4S,8R)-8-methoxy-1,8-dimethyl-6-(2-methylpropyl)bicyclo[2.2.2]oct-5-en-2-one (PubChem CID 11322327) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1S,4S,8R)-8-methoxy-1,8-dimethyl-6-(2-methylpropyl)bicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,4S,8R)-8-methoxy-1,8-dimethyl-6-(2-methylpropyl)bicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 11322327 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1S,4S,8R)-8-methoxy-1,8-dimethyl-6-(2-methylpropyl)bicyclo[2.2.2]oct-5-en-2-one |
| SMILES | CO[C@]1(C)C[C@]2(C)C(=O)C[C@H]1C=C2CC(C)C |
| InChI | InChI=1S/C15H24O2/c1-10(2)6-11-7-12-8-13(16)14(11,3)9-15(12,4)17-5/h7,10,12H,6,8-9H2,1-5H3/t12-,14+,15-/m1/s1 |
| InChIKey | KJETWJMXGBFWMI-VHDGCEQUSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|